C15H23NaO4 — CID 160844928
sodium 5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoate (PubChem CID 160844928) has the molecular formula C15H23NaO4 and a molecular weight of 290.33 g/mol. Its IUPAC name is sodium 5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoate.
| Compound Name | sodium 5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoate |
|---|---|
| PubChem CID | 160844928 |
| Molecular Formula | C15H23NaO4 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | sodium 5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoate |
| SMILES | CC(C)=CCC/C(C)=C/COC(=O)CCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C15H24O4.Na/c1-12(2)6-4-7-13(3)10-11-19-15(18)9-5-8-14(16)17;/h6,10H,4-5,7-9,11H2,1-3H3,(H,16,17);/q;+1/p-1/b13-10+; |
| InChIKey | POZCDMUGTATSGT-RSGUCCNWSA-M |
| XLogP | -0.85 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|