C15H24O4 — CID 87993792
5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid (PubChem CID 87993792) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid.
| Compound Name | 5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 87993792 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid |
| SMILES | CC(C)=CCC/C(C)=C/COC(=O)CCCC(=O)O |
| InChI | InChI=1S/C15H24O4/c1-12(2)6-4-7-13(3)10-11-19-15(18)9-5-8-14(16)17/h6,10H,4-5,7-9,11H2,1-3H3,(H,16,17)/b13-10+ |
| InChIKey | SINBKMRTZHNALO-JLHYYAGUSA-N |
| XLogP | 3.48 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|