5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid

C15H24O4 — CID 87993792

IUPAC5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid
SMILESCC(C)=CCC/C(C)=C/COC(=O)CCCC(=O)O
InChIInChI=1S/C15H24O4/c1-12(2)6-4-7-13(3)10-11-19-15(18)9-5-8-14(16)17/h6,10H,4-5,7-9,11H2,1-3H3,(H,16,17)/b13-10+
InChIKeySINBKMRTZHNALO-JLHYYAGUSA-N
MW268.35 g/mol
LogP3.48
Rot. Bonds9

About 5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid

5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid (PubChem CID 87993792) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid.

Molecular Properties

Compound Name5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid
PubChem CID87993792
Molecular FormulaC15H24O4
Molecular Weight268.35 g/mol
Exact Mass268.17
IUPAC Name5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid
SMILESCC(C)=CCC/C(C)=C/COC(=O)CCCC(=O)O
InChIInChI=1S/C15H24O4/c1-12(2)6-4-7-13(3)10-11-19-15(18)9-5-8-14(16)17/h6,10H,4-5,7-9,11H2,1-3H3,(H,16,17)/b13-10+
InChIKeySINBKMRTZHNALO-JLHYYAGUSA-N
XLogP3.48
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.35
LogP ≤ 53.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid?
The IUPAC name of 5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid (CID 87993792) is 5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid.
What is the SMILES notation for 5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid?
The canonical SMILES for 5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid is CC(C)=CCC/C(C)=C/COC(=O)CCCC(=O)O.
What is the InChIKey of 5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid?
The InChIKey is SINBKMRTZHNALO-JLHYYAGUSA-N. The full InChI is InChI=1S/C15H24O4/c1-12(2)6-4-7-13(3)10-11-19-15(18)9-5-8-14(16)17/h6,10H,4-5,7-9,11H2,1-3H3,(H,16,17)/b13-10+.
What are the key properties of 5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid?
5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid has a molecular weight of 268.35 g/mol, XLogP of 3.48, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-oxopentanoic acid is sourced from PubChem (CID 87993792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).