About 3-methylbut-2-enyl 3-oxobutanoate
3-methylbut-2-enyl 3-oxobutanoate (PubChem CID 4173429) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is 3-methylbut-2-enyl 3-oxobutanoate.
Molecular Properties
| Compound Name | 3-methylbut-2-enyl 3-oxobutanoate |
| PubChem CID | 4173429 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 3-methylbut-2-enyl 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OCC=C(C)C |
| InChI | InChI=1S/C9H14O3/c1-7(2)4-5-12-9(11)6-8(3)10/h4H,5-6H2,1-3H3 |
| InChIKey | HWIAQCZAVCBIHB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-2-enyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-2-enyl 3-oxobutanoate?
The IUPAC name of 3-methylbut-2-enyl 3-oxobutanoate (CID 4173429) is 3-methylbut-2-enyl 3-oxobutanoate.
What is the SMILES notation for 3-methylbut-2-enyl 3-oxobutanoate?
The canonical SMILES for 3-methylbut-2-enyl 3-oxobutanoate is CC(=O)CC(=O)OCC=C(C)C.
What is the InChIKey of 3-methylbut-2-enyl 3-oxobutanoate?
The InChIKey is HWIAQCZAVCBIHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-7(2)4-5-12-9(11)6-8(3)10/h4H,5-6H2,1-3H3.
What are the key properties of 3-methylbut-2-enyl 3-oxobutanoate?
3-methylbut-2-enyl 3-oxobutanoate has a molecular weight of 170.21 g/mol, XLogP of 1.47, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-2-enyl 3-oxobutanoate is sourced from PubChem (CID 4173429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).