About 4-oxobut-2-enyl 3-oxobutanoate
4-oxobut-2-enyl 3-oxobutanoate (PubChem CID 174572050) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is 4-oxobut-2-enyl 3-oxobutanoate.
Molecular Properties
| Compound Name | 4-oxobut-2-enyl 3-oxobutanoate |
| PubChem CID | 174572050 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 4-oxobut-2-enyl 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OCC=CC=O |
| InChI | InChI=1S/C8H10O4/c1-7(10)6-8(11)12-5-3-2-4-9/h2-4H,5-6H2,1H3 |
| InChIKey | KXDIQVHTTSRXCL-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-oxobut-2-enyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxobut-2-enyl 3-oxobutanoate?
The IUPAC name of 4-oxobut-2-enyl 3-oxobutanoate (CID 174572050) is 4-oxobut-2-enyl 3-oxobutanoate.
What is the SMILES notation for 4-oxobut-2-enyl 3-oxobutanoate?
The canonical SMILES for 4-oxobut-2-enyl 3-oxobutanoate is CC(=O)CC(=O)OCC=CC=O.
What is the InChIKey of 4-oxobut-2-enyl 3-oxobutanoate?
The InChIKey is KXDIQVHTTSRXCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4/c1-7(10)6-8(11)12-5-3-2-4-9/h2-4H,5-6H2,1H3.
What are the key properties of 4-oxobut-2-enyl 3-oxobutanoate?
4-oxobut-2-enyl 3-oxobutanoate has a molecular weight of 170.16 g/mol, XLogP of 0.26, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxobut-2-enyl 3-oxobutanoate is sourced from PubChem (CID 174572050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).