C14H22F4O4 — CID 91734947
4-O-(2,4-dimethylpentan-3-yl) 1-O-(2,2,3,3-tetrafluoropropyl) butanedioate (PubChem CID 91734947) has the molecular formula C14H22F4O4 and a molecular weight of 330.32 g/mol. Its IUPAC name is 4-O-(2,4-dimethylpentan-3-yl) 1-O-(2,2,3,3-tetrafluoropropyl) butanedioate.
| Compound Name | 4-O-(2,4-dimethylpentan-3-yl) 1-O-(2,2,3,3-tetrafluoropropyl) butanedioate |
|---|---|
| PubChem CID | 91734947 |
| Molecular Formula | C14H22F4O4 |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 4-O-(2,4-dimethylpentan-3-yl) 1-O-(2,2,3,3-tetrafluoropropyl) butanedioate |
| SMILES | CC(C)C(OC(=O)CCC(=O)OCC(F)(F)C(F)F)C(C)C |
| InChI | InChI=1S/C14H22F4O4/c1-8(2)12(9(3)4)22-11(20)6-5-10(19)21-7-14(17,18)13(15)16/h8-9,12-13H,5-7H2,1-4H3 |
| InChIKey | LTRAQBXIYJIDCW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|