C14H14BrF4NO3 — CID 4274751
2,2,3,3-tetrafluoropropyl 5-(2-bromoanilino)-5-oxopentanoate (PubChem CID 4274751) has the molecular formula C14H14BrF4NO3 and a molecular weight of 400.17 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl 5-(2-bromoanilino)-5-oxopentanoate.
| Compound Name | 2,2,3,3-tetrafluoropropyl 5-(2-bromoanilino)-5-oxopentanoate |
|---|---|
| PubChem CID | 4274751 |
| Molecular Formula | C14H14BrF4NO3 |
| Molecular Weight | 400.17 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 5-(2-bromoanilino)-5-oxopentanoate |
| SMILES | O=C(CCCC(=O)OCC(F)(F)C(F)F)Nc1ccccc1Br |
| InChI | InChI=1S/C14H14BrF4NO3/c15-9-4-1-2-5-10(9)20-11(21)6-3-7-12(22)23-8-14(18,19)13(16)17/h1-2,4-5,13H,3,6-8H2,(H,20,21) |
| InChIKey | RJBFBZVVRUFCES-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.17 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|