C10H10BrF3N2O — CID 28595976
N-(2-bromophenyl)-2-(2,2,2-trifluoroethylamino)acetamide (PubChem CID 28595976) has the molecular formula C10H10BrF3N2O and a molecular weight of 311.10 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-(2,2,2-trifluoroethylamino)acetamide.
| Compound Name | N-(2-bromophenyl)-2-(2,2,2-trifluoroethylamino)acetamide |
|---|---|
| PubChem CID | 28595976 |
| Molecular Formula | C10H10BrF3N2O |
| Molecular Weight | 311.10 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | N-(2-bromophenyl)-2-(2,2,2-trifluoroethylamino)acetamide |
| SMILES | O=C(CNCC(F)(F)F)Nc1ccccc1Br |
| InChI | InChI=1S/C10H10BrF3N2O/c11-7-3-1-2-4-8(7)16-9(17)5-15-6-10(12,13)14/h1-4,15H,5-6H2,(H,16,17) |
| InChIKey | YKEBPOYFCJRHMB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.10 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |