C12H14F3N3O2 — CID 78957981
N-methyl-2-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]benzamide (PubChem CID 78957981) has the molecular formula C12H14F3N3O2 and a molecular weight of 289.26 g/mol. Its IUPAC name is N-methyl-2-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]benzamide.
| Compound Name | N-methyl-2-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 78957981 |
| Molecular Formula | C12H14F3N3O2 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-methyl-2-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]benzamide |
| SMILES | CNC(=O)c1ccccc1NC(=O)CNCC(F)(F)F |
| InChI | InChI=1S/C12H14F3N3O2/c1-16-11(20)8-4-2-3-5-9(8)18-10(19)6-17-7-12(13,14)15/h2-5,17H,6-7H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | UDCXSQCHTSOAGL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |