C12H13F3N2O2S — CID 47029177
N,2-dimethyl-3-[[2-(trifluoromethylsulfanyl)acetyl]amino]benzamide (PubChem CID 47029177) has the molecular formula C12H13F3N2O2S and a molecular weight of 306.31 g/mol. Its IUPAC name is N,2-dimethyl-3-[[2-(trifluoromethylsulfanyl)acetyl]amino]benzamide.
| Compound Name | N,2-dimethyl-3-[[2-(trifluoromethylsulfanyl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 47029177 |
| Molecular Formula | C12H13F3N2O2S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | N,2-dimethyl-3-[[2-(trifluoromethylsulfanyl)acetyl]amino]benzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)CSC(F)(F)F)c1C |
| InChI | InChI=1S/C12H13F3N2O2S/c1-7-8(11(19)16-2)4-3-5-9(7)17-10(18)6-20-12(13,14)15/h3-5H,6H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | KUXJPOUKXTVNIA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |