C17H23N3O3 — CID 46434201
3-[[2-(cyclopentanecarbonylamino)acetyl]amino]-N,2-dimethylbenzamide (PubChem CID 46434201) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 3-[[2-(cyclopentanecarbonylamino)acetyl]amino]-N,2-dimethylbenzamide.
| Compound Name | 3-[[2-(cyclopentanecarbonylamino)acetyl]amino]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 46434201 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 3-[[2-(cyclopentanecarbonylamino)acetyl]amino]-N,2-dimethylbenzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)CNC(=O)C2CCCC2)c1C |
| InChI | InChI=1S/C17H23N3O3/c1-11-13(17(23)18-2)8-5-9-14(11)20-15(21)10-19-16(22)12-6-3-4-7-12/h5,8-9,12H,3-4,6-7,10H2,1-2H3,(H,18,23)(H,19,22)(H,20,21) |
| InChIKey | PNBBJPCOINZLFA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |