C16H23N3O2 — CID 60851927
3-[(4-aminocyclohexanecarbonyl)amino]-N,2-dimethylbenzamide (PubChem CID 60851927) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 3-[(4-aminocyclohexanecarbonyl)amino]-N,2-dimethylbenzamide.
| Compound Name | 3-[(4-aminocyclohexanecarbonyl)amino]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 60851927 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 3-[(4-aminocyclohexanecarbonyl)amino]-N,2-dimethylbenzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)C2CCC(N)CC2)c1C |
| InChI | InChI=1S/C16H23N3O2/c1-10-13(16(21)18-2)4-3-5-14(10)19-15(20)11-6-8-12(17)9-7-11/h3-5,11-12H,6-9,17H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | SRLFULRPQZIGCQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |