C18H20N2O2 — CID 46461694
3-[(4-ethylbenzoyl)amino]-N,2-dimethylbenzamide (PubChem CID 46461694) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-[(4-ethylbenzoyl)amino]-N,2-dimethylbenzamide.
| Compound Name | 3-[(4-ethylbenzoyl)amino]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 46461694 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 3-[(4-ethylbenzoyl)amino]-N,2-dimethylbenzamide |
| SMILES | CCc1ccc(C(=O)Nc2cccc(C(=O)NC)c2C)cc1 |
| InChI | InChI=1S/C18H20N2O2/c1-4-13-8-10-14(11-9-13)17(21)20-16-7-5-6-15(12(16)2)18(22)19-3/h5-11H,4H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | GPYXDHAIVOKFOC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |