C19H20N2O4 — CID 17341399
methyl 2-methyl-3-[[4-(propanoylamino)benzoyl]amino]benzoate (PubChem CID 17341399) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is methyl 2-methyl-3-[[4-(propanoylamino)benzoyl]amino]benzoate.
| Compound Name | methyl 2-methyl-3-[[4-(propanoylamino)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 17341399 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | methyl 2-methyl-3-[[4-(propanoylamino)benzoyl]amino]benzoate |
| SMILES | CCC(=O)Nc1ccc(C(=O)Nc2cccc(C(=O)OC)c2C)cc1 |
| InChI | InChI=1S/C19H20N2O4/c1-4-17(22)20-14-10-8-13(9-11-14)18(23)21-16-7-5-6-15(12(16)2)19(24)25-3/h5-11H,4H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | KEZHSLKMGNWICY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |