C13H12BrF4NO3 — CID 4519243
2,2,3,3-tetrafluoropropyl 4-(2-bromoanilino)-4-oxobutanoate (PubChem CID 4519243) has the molecular formula C13H12BrF4NO3 and a molecular weight of 386.14 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl 4-(2-bromoanilino)-4-oxobutanoate.
| Compound Name | 2,2,3,3-tetrafluoropropyl 4-(2-bromoanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 4519243 |
| Molecular Formula | C13H12BrF4NO3 |
| Molecular Weight | 386.14 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 4-(2-bromoanilino)-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OCC(F)(F)C(F)F)Nc1ccccc1Br |
| InChI | InChI=1S/C13H12BrF4NO3/c14-8-3-1-2-4-9(8)19-10(20)5-6-11(21)22-7-13(17,18)12(15)16/h1-4,12H,5-7H2,(H,19,20) |
| InChIKey | FZQJLMGURKVVBK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.14 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|