C14H13F3NO5- — CID 7791859
2-[[5-oxo-5-(2,2,2-trifluoroethoxy)pentanoyl]amino]benzoate (PubChem CID 7791859) has the molecular formula C14H13F3NO5- and a molecular weight of 332.25 g/mol. Its IUPAC name is 2-[[5-oxo-5-(2,2,2-trifluoroethoxy)pentanoyl]amino]benzoate.
| Compound Name | 2-[[5-oxo-5-(2,2,2-trifluoroethoxy)pentanoyl]amino]benzoate |
|---|---|
| PubChem CID | 7791859 |
| Molecular Formula | C14H13F3NO5- |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2-[[5-oxo-5-(2,2,2-trifluoroethoxy)pentanoyl]amino]benzoate |
| SMILES | O=C(CCCC(=O)OCC(F)(F)F)Nc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C14H14F3NO5/c15-14(16,17)8-23-12(20)7-3-6-11(19)18-10-5-2-1-4-9(10)13(21)22/h1-2,4-5H,3,6-8H2,(H,18,19)(H,21,22)/p-1 |
| InChIKey | LBIRFYXSUCYBQS-UHFFFAOYSA-M |
| XLogP | 1.26 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |