C12H13N2O4- — CID 3574858
2-[[3-(ethylamino)-3-oxopropanoyl]amino]benzoate (PubChem CID 3574858) has the molecular formula C12H13N2O4- and a molecular weight of 249.25 g/mol. Its IUPAC name is 2-[[3-(ethylamino)-3-oxopropanoyl]amino]benzoate.
| Compound Name | 2-[[3-(ethylamino)-3-oxopropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 3574858 |
| Molecular Formula | C12H13N2O4- |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 2-[[3-(ethylamino)-3-oxopropanoyl]amino]benzoate |
| SMILES | CCNC(=O)CC(=O)Nc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C12H14N2O4/c1-2-13-10(15)7-11(16)14-9-6-4-3-5-8(9)12(17)18/h3-6H,2,7H2,1H3,(H,13,15)(H,14,16)(H,17,18)/p-1 |
| InChIKey | PXKBKZAWZXPPFU-UHFFFAOYSA-M |
| XLogP | -0.49 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|