C16H19N2O4- — CID 6990965
2-[[3-(cyclohexylamino)-3-oxopropanoyl]amino]benzoate (PubChem CID 6990965) has the molecular formula C16H19N2O4- and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-[[3-(cyclohexylamino)-3-oxopropanoyl]amino]benzoate.
| Compound Name | 2-[[3-(cyclohexylamino)-3-oxopropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 6990965 |
| Molecular Formula | C16H19N2O4- |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-[[3-(cyclohexylamino)-3-oxopropanoyl]amino]benzoate |
| SMILES | O=C(CC(=O)NC1CCCCC1)Nc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C16H20N2O4/c19-14(17-11-6-2-1-3-7-11)10-15(20)18-13-9-5-4-8-12(13)16(21)22/h4-5,8-9,11H,1-3,6-7,10H2,(H,17,19)(H,18,20)(H,21,22)/p-1 |
| InChIKey | DFZHQVDKRMPUCG-UHFFFAOYSA-M |
| XLogP | 0.83 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|