C17H16NO3- — CID 6957947
2-[[(2R)-2-phenylbutanoyl]amino]benzoate (PubChem CID 6957947) has the molecular formula C17H16NO3- and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-[[(2R)-2-phenylbutanoyl]amino]benzoate.
| Compound Name | 2-[[(2R)-2-phenylbutanoyl]amino]benzoate |
|---|---|
| PubChem CID | 6957947 |
| Molecular Formula | C17H16NO3- |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-[[(2R)-2-phenylbutanoyl]amino]benzoate |
| SMILES | CC[C@@H](C(=O)Nc1ccccc1C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C17H17NO3/c1-2-13(12-8-4-3-5-9-12)16(19)18-15-11-7-6-10-14(15)17(20)21/h3-11,13H,2H2,1H3,(H,18,19)(H,20,21)/p-1/t13-/m1/s1 |
| InChIKey | AVWXAXAJRWROND-CYBMUJFWSA-M |
| XLogP | 2.18 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |