C13H8F14O4 — CID 139640341
bis(2,2,3,3,4,4,4-heptafluorobutyl) (Z)-2-methylbut-2-enedioate (PubChem CID 139640341) has the molecular formula C13H8F14O4 and a molecular weight of 494.18 g/mol. Its IUPAC name is bis(2,2,3,3,4,4,4-heptafluorobutyl) (Z)-2-methylbut-2-enedioate.
| Compound Name | bis(2,2,3,3,4,4,4-heptafluorobutyl) (Z)-2-methylbut-2-enedioate |
|---|---|
| PubChem CID | 139640341 |
| Molecular Formula | C13H8F14O4 |
| Molecular Weight | 494.18 g/mol |
| Exact Mass | 494.02 |
| IUPAC Name | bis(2,2,3,3,4,4,4-heptafluorobutyl) (Z)-2-methylbut-2-enedioate |
| SMILES | C/C(=C/C(=O)OCC(F)(F)C(F)(F)C(F)(F)F)C(=O)OCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H8F14O4/c1-5(7(29)31-4-9(16,17)11(20,21)13(25,26)27)2-6(28)30-3-8(14,15)10(18,19)12(22,23)24/h2H,3-4H2,1H3/b5-2- |
| InChIKey | ZMPZRUAWEURBDN-DJWKRKHSSA-N |
| XLogP | 4.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.18 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|