C15H11F15O4 — CID 175111570
3-hydroxypropyl 5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-pentadecafluoro-2-methyl-4-oxoundec-2-enoate (PubChem CID 175111570) has the molecular formula C15H11F15O4 and a molecular weight of 540.22 g/mol. Its IUPAC name is 3-hydroxypropyl 5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-pentadecafluoro-2-methyl-4-oxoundec-2-enoate.
| Compound Name | 3-hydroxypropyl 5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-pentadecafluoro-2-methyl-4-oxoundec-2-enoate |
|---|---|
| PubChem CID | 175111570 |
| Molecular Formula | C15H11F15O4 |
| Molecular Weight | 540.22 g/mol |
| Exact Mass | 540.04 |
| IUPAC Name | 3-hydroxypropyl 5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-pentadecafluoro-2-methyl-4-oxoundec-2-enoate |
| SMILES | CC(=CC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCCO |
| InChI | InChI=1S/C15H11F15O4/c1-6(8(33)34-4-2-3-31)5-7(32)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)30/h5,31H,2-4H2,1H3 |
| InChIKey | UWMJQFGMPYNVKE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.22 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|