C16H9F21O3 — CID 175231805
2-hydroxyethyl 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-methyltridec-2-enoate (PubChem CID 175231805) has the molecular formula C16H9F21O3 and a molecular weight of 648.20 g/mol. Its IUPAC name is 2-hydroxyethyl 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-methyltridec-2-enoate.
| Compound Name | 2-hydroxyethyl 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-methyltridec-2-enoate |
|---|---|
| PubChem CID | 175231805 |
| Molecular Formula | C16H9F21O3 |
| Molecular Weight | 648.20 g/mol |
| Exact Mass | 648.02 |
| IUPAC Name | 2-hydroxyethyl 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-henicosafluoro-2-methyltridec-2-enoate |
| SMILES | CC(=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCO |
| InChI | InChI=1S/C16H9F21O3/c1-5(6(39)40-3-2-38)4-7(17,18)8(19,20)9(21,22)10(23,24)11(25,26)12(27,28)13(29,30)14(31,32)15(33,34)16(35,36)37/h4,38H,2-3H2,1H3 |
| InChIKey | CRPJAAYJTPWHIS-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.20 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|