C7H5F9O3 — CID 13278449
2-hydroxyethyl 2,2,3,3,4,4,5,5,5-nonafluoropentanoate (PubChem CID 13278449) has the molecular formula C7H5F9O3 and a molecular weight of 308.10 g/mol. Its IUPAC name is 2-hydroxyethyl 2,2,3,3,4,4,5,5,5-nonafluoropentanoate.
| Compound Name | 2-hydroxyethyl 2,2,3,3,4,4,5,5,5-nonafluoropentanoate |
|---|---|
| PubChem CID | 13278449 |
| Molecular Formula | C7H5F9O3 |
| Molecular Weight | 308.10 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 2-hydroxyethyl 2,2,3,3,4,4,5,5,5-nonafluoropentanoate |
| SMILES | O=C(OCCO)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H5F9O3/c8-4(9,3(18)19-2-1-17)5(10,11)6(12,13)7(14,15)16/h17H,1-2H2 |
| InChIKey | UJXNJXHBUSAQBQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.10 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|