C12H11F11O3 — CID 141293636
4-ethenoxybutyl 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoate (PubChem CID 141293636) has the molecular formula C12H11F11O3 and a molecular weight of 412.20 g/mol. Its IUPAC name is 4-ethenoxybutyl 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoate.
| Compound Name | 4-ethenoxybutyl 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoate |
|---|---|
| PubChem CID | 141293636 |
| Molecular Formula | C12H11F11O3 |
| Molecular Weight | 412.20 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 4-ethenoxybutyl 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexanoate |
| SMILES | C=COCCCCOC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H11F11O3/c1-2-25-5-3-4-6-26-7(24)8(13,14)9(15,16)10(17,18)11(19,20)12(21,22)23/h2H,1,3-6H2 |
| InChIKey | RMUGVCIORAKEHJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.20 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|