C14H13F14NO3 — CID 91736164
6-(2,2,3,3,4,4,4-heptafluorobutanoylamino)hexyl 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91736164) has the molecular formula C14H13F14NO3 and a molecular weight of 509.23 g/mol. Its IUPAC name is 6-(2,2,3,3,4,4,4-heptafluorobutanoylamino)hexyl 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | 6-(2,2,3,3,4,4,4-heptafluorobutanoylamino)hexyl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91736164 |
| Molecular Formula | C14H13F14NO3 |
| Molecular Weight | 509.23 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | 6-(2,2,3,3,4,4,4-heptafluorobutanoylamino)hexyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | O=C(NCCCCCCOC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H13F14NO3/c15-9(16,11(19,20)13(23,24)25)7(30)29-5-3-1-2-4-6-32-8(31)10(17,18)12(21,22)14(26,27)28/h1-6H2,(H,29,30) |
| InChIKey | AIEANBIIGMZCRV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.23 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|