C6HF11O3 — CID 14492204
2,2,3,3,4,4,5,5,6,6,6-undecafluorohexaneperoxoic acid (PubChem CID 14492204) has the molecular formula C6HF11O3 and a molecular weight of 330.05 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexaneperoxoic acid.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexaneperoxoic acid |
|---|---|
| PubChem CID | 14492204 |
| Molecular Formula | C6HF11O3 |
| Molecular Weight | 330.05 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,6-undecafluorohexaneperoxoic acid |
| SMILES | O=C(OO)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6HF11O3/c7-2(8,1(18)20-19)3(9,10)4(11,12)5(13,14)6(15,16)17/h19H |
| InChIKey | MMKNYRUQKCIDCI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.05 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|