C8H4ClF9O4 — CID 91725228
2-(2-chloro-2,2-difluoroacetyl)oxyethyl 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91725228) has the molecular formula C8H4ClF9O4 and a molecular weight of 370.55 g/mol. Its IUPAC name is 2-(2-chloro-2,2-difluoroacetyl)oxyethyl 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | 2-(2-chloro-2,2-difluoroacetyl)oxyethyl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91725228 |
| Molecular Formula | C8H4ClF9O4 |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | 2-(2-chloro-2,2-difluoroacetyl)oxyethyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | O=C(OCCOC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)Cl |
| InChI | InChI=1S/C8H4ClF9O4/c9-6(12,13)4(20)22-2-1-21-3(19)5(10,11)7(14,15)8(16,17)18/h1-2H2 |
| InChIKey | GXVRUNRZBFSWHZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|