C18H11F21O6 — CID 91697752
2,2-bis(2,2,3,3,4,4,4-heptafluorobutanoyloxymethyl)butyl 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91697752) has the molecular formula C18H11F21O6 and a molecular weight of 722.24 g/mol. Its IUPAC name is 2,2-bis(2,2,3,3,4,4,4-heptafluorobutanoyloxymethyl)butyl 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | 2,2-bis(2,2,3,3,4,4,4-heptafluorobutanoyloxymethyl)butyl 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91697752 |
| Molecular Formula | C18H11F21O6 |
| Molecular Weight | 722.24 g/mol |
| Exact Mass | 722.02 |
| IUPAC Name | 2,2-bis(2,2,3,3,4,4,4-heptafluorobutanoyloxymethyl)butyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CCC(COC(=O)C(F)(F)C(F)(F)C(F)(F)F)(COC(=O)C(F)(F)C(F)(F)C(F)(F)F)COC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H11F21O6/c1-2-9(3-43-6(40)10(19,20)13(25,26)16(31,32)33,4-44-7(41)11(21,22)14(27,28)17(34,35)36)5-45-8(42)12(23,24)15(29,30)18(37,38)39/h2-5H2,1H3 |
| InChIKey | IDAYENACLZKAEB-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.24 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|