C12H15F7O4 — CID 542340
(4-butoxy-4-oxobutyl) 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 542340) has the molecular formula C12H15F7O4 and a molecular weight of 356.23 g/mol. Its IUPAC name is (4-butoxy-4-oxobutyl) 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | (4-butoxy-4-oxobutyl) 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 542340 |
| Molecular Formula | C12H15F7O4 |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | (4-butoxy-4-oxobutyl) 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CCCCOC(=O)CCCOC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H15F7O4/c1-2-3-6-22-8(20)5-4-7-23-9(21)10(13,14)11(15,16)12(17,18)19/h2-7H2,1H3 |
| InChIKey | GPLYXKUGAXCCSW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|