C13H21F5O2 — CID 536957
decyl 2,2,3,3,3-pentafluoropropanoate (PubChem CID 536957) has the molecular formula C13H21F5O2 and a molecular weight of 304.30 g/mol. Its IUPAC name is decyl 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | decyl 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 536957 |
| Molecular Formula | C13H21F5O2 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | decyl 2,2,3,3,3-pentafluoropropanoate |
| SMILES | CCCCCCCCCCOC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H21F5O2/c1-2-3-4-5-6-7-8-9-10-20-11(19)12(14,15)13(16,17)18/h2-10H2,1H3 |
| InChIKey | VVIWDHAVGIYAEE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|