C11H16ClF5O2 — CID 91692487
8-chlorooctyl 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91692487) has the molecular formula C11H16ClF5O2 and a molecular weight of 310.69 g/mol. Its IUPAC name is 8-chlorooctyl 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | 8-chlorooctyl 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91692487 |
| Molecular Formula | C11H16ClF5O2 |
| Molecular Weight | 310.69 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 8-chlorooctyl 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(OCCCCCCCCCl)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H16ClF5O2/c12-7-5-3-1-2-4-6-8-19-9(18)10(13,14)11(15,16)17/h1-8H2 |
| InChIKey | ZEXPGMONEHPQPZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.69 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|