About 8-chlorooctyl 2,2-dichloroacetate
8-chlorooctyl 2,2-dichloroacetate (PubChem CID 13031329) has the molecular formula C10H17Cl3O2
and a molecular weight of 275.60 g/mol. Its IUPAC name is 8-chlorooctyl 2,2-dichloroacetate.
Molecular Properties
| Compound Name | 8-chlorooctyl 2,2-dichloroacetate |
| PubChem CID | 13031329 |
| Molecular Formula | C10H17Cl3O2 |
| Molecular Weight | 275.60 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 8-chlorooctyl 2,2-dichloroacetate |
| SMILES | O=C(OCCCCCCCCCl)C(Cl)Cl |
| InChI | InChI=1S/C10H17Cl3O2/c11-7-5-3-1-2-4-6-8-15-10(14)9(12)13/h9H,1-8H2 |
| InChIKey | FDJHTHGSNGTWSO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.60 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 8-chlorooctyl 2,2-dichloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chlorooctyl 2,2-dichloroacetate?
The IUPAC name of 8-chlorooctyl 2,2-dichloroacetate (CID 13031329) is 8-chlorooctyl 2,2-dichloroacetate.
What is the SMILES notation for 8-chlorooctyl 2,2-dichloroacetate?
The canonical SMILES for 8-chlorooctyl 2,2-dichloroacetate is O=C(OCCCCCCCCCl)C(Cl)Cl.
What is the InChIKey of 8-chlorooctyl 2,2-dichloroacetate?
The InChIKey is FDJHTHGSNGTWSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17Cl3O2/c11-7-5-3-1-2-4-6-8-15-10(14)9(12)13/h9H,1-8H2.
What are the key properties of 8-chlorooctyl 2,2-dichloroacetate?
8-chlorooctyl 2,2-dichloroacetate has a molecular weight of 275.60 g/mol, XLogP of 3.91, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chlorooctyl 2,2-dichloroacetate is sourced from PubChem (CID 13031329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).