About 8-chlorooctyl ethyl carbonate
8-chlorooctyl ethyl carbonate (PubChem CID 91699397) has the molecular formula C11H21ClO3
and a molecular weight of 236.74 g/mol. Its IUPAC name is 8-chlorooctyl ethyl carbonate.
Molecular Properties
| Compound Name | 8-chlorooctyl ethyl carbonate |
| PubChem CID | 91699397 |
| Molecular Formula | C11H21ClO3 |
| Molecular Weight | 236.74 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 8-chlorooctyl ethyl carbonate |
| SMILES | CCOC(=O)OCCCCCCCCCl |
| InChI | InChI=1S/C11H21ClO3/c1-2-14-11(13)15-10-8-6-4-3-5-7-9-12/h2-10H2,1H3 |
| InChIKey | SWQKLBIZVFJKQV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.74 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 8-chlorooctyl ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chlorooctyl ethyl carbonate?
The IUPAC name of 8-chlorooctyl ethyl carbonate (CID 91699397) is 8-chlorooctyl ethyl carbonate.
What is the SMILES notation for 8-chlorooctyl ethyl carbonate?
The canonical SMILES for 8-chlorooctyl ethyl carbonate is CCOC(=O)OCCCCCCCCCl.
What is the InChIKey of 8-chlorooctyl ethyl carbonate?
The InChIKey is SWQKLBIZVFJKQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21ClO3/c1-2-14-11(13)15-10-8-6-4-3-5-7-9-12/h2-10H2,1H3.
What are the key properties of 8-chlorooctyl ethyl carbonate?
8-chlorooctyl ethyl carbonate has a molecular weight of 236.74 g/mol, XLogP of 3.74, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chlorooctyl ethyl carbonate is sourced from PubChem (CID 91699397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).