About 8-chlorooctyl acetate
8-chlorooctyl acetate (PubChem CID 527879) has the molecular formula C10H19ClO2
and a molecular weight of 206.71 g/mol. Its IUPAC name is 8-chlorooctyl acetate.
Molecular Properties
| Compound Name | 8-chlorooctyl acetate |
| PubChem CID | 527879 |
| Molecular Formula | C10H19ClO2 |
| Molecular Weight | 206.71 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 8-chlorooctyl acetate |
| SMILES | CC(=O)OCCCCCCCCCl |
| InChI | InChI=1S/C10H19ClO2/c1-10(12)13-9-7-5-3-2-4-6-8-11/h2-9H2,1H3 |
| InChIKey | GMADNPIAEYOEIL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.71 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 8-chlorooctyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chlorooctyl acetate?
The IUPAC name of 8-chlorooctyl acetate (CID 527879) is 8-chlorooctyl acetate.
What is the SMILES notation for 8-chlorooctyl acetate?
The canonical SMILES for 8-chlorooctyl acetate is CC(=O)OCCCCCCCCCl.
What is the InChIKey of 8-chlorooctyl acetate?
The InChIKey is GMADNPIAEYOEIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19ClO2/c1-10(12)13-9-7-5-3-2-4-6-8-11/h2-9H2,1H3.
What are the key properties of 8-chlorooctyl acetate?
8-chlorooctyl acetate has a molecular weight of 206.71 g/mol, XLogP of 3.13, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chlorooctyl acetate is sourced from PubChem (CID 527879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).