About 11-sulfanylundecyl acetate
11-sulfanylundecyl acetate (PubChem CID 101045220) has the molecular formula C13H26O2S
and a molecular weight of 246.42 g/mol. Its IUPAC name is 11-sulfanylundecyl acetate.
Molecular Properties
| Compound Name | 11-sulfanylundecyl acetate |
| PubChem CID | 101045220 |
| Molecular Formula | C13H26O2S |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 11-sulfanylundecyl acetate |
| SMILES | CC(=O)OCCCCCCCCCCCS |
| InChI | InChI=1S/C13H26O2S/c1-13(14)15-11-9-7-5-3-2-4-6-8-10-12-16/h16H,2-12H2,1H3 |
| InChIKey | FNCUZYQBONBBAX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 11-sulfanylundecyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-sulfanylundecyl acetate?
The IUPAC name of 11-sulfanylundecyl acetate (CID 101045220) is 11-sulfanylundecyl acetate.
What is the SMILES notation for 11-sulfanylundecyl acetate?
The canonical SMILES for 11-sulfanylundecyl acetate is CC(=O)OCCCCCCCCCCCS.
What is the InChIKey of 11-sulfanylundecyl acetate?
The InChIKey is FNCUZYQBONBBAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2S/c1-13(14)15-11-9-7-5-3-2-4-6-8-10-12-16/h16H,2-12H2,1H3.
What are the key properties of 11-sulfanylundecyl acetate?
11-sulfanylundecyl acetate has a molecular weight of 246.42 g/mol, XLogP of 3.99, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-sulfanylundecyl acetate is sourced from PubChem (CID 101045220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).