About 8-sulfanyloctyl acetate
8-sulfanyloctyl acetate (PubChem CID 19068319) has the molecular formula C10H20O2S
and a molecular weight of 204.33 g/mol. Its IUPAC name is 8-sulfanyloctyl acetate.
Molecular Properties
| Compound Name | 8-sulfanyloctyl acetate |
| PubChem CID | 19068319 |
| Molecular Formula | C10H20O2S |
| Molecular Weight | 204.33 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 8-sulfanyloctyl acetate |
| SMILES | CC(=O)OCCCCCCCCS |
| InChI | InChI=1S/C10H20O2S/c1-10(11)12-8-6-4-2-3-5-7-9-13/h13H,2-9H2,1H3 |
| InChIKey | ZLUALEXIJPWJAB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 8-sulfanyloctyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-sulfanyloctyl acetate?
The IUPAC name of 8-sulfanyloctyl acetate (CID 19068319) is 8-sulfanyloctyl acetate.
What is the SMILES notation for 8-sulfanyloctyl acetate?
The canonical SMILES for 8-sulfanyloctyl acetate is CC(=O)OCCCCCCCCS.
What is the InChIKey of 8-sulfanyloctyl acetate?
The InChIKey is ZLUALEXIJPWJAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2S/c1-10(11)12-8-6-4-2-3-5-7-9-13/h13H,2-9H2,1H3.
What are the key properties of 8-sulfanyloctyl acetate?
8-sulfanyloctyl acetate has a molecular weight of 204.33 g/mol, XLogP of 2.82, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-sulfanyloctyl acetate is sourced from PubChem (CID 19068319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).