About 5-chloropentyl methyl carbonate
5-chloropentyl methyl carbonate (PubChem CID 103970733) has the molecular formula C7H13ClO3
and a molecular weight of 180.63 g/mol. Its IUPAC name is 5-chloropentyl methyl carbonate.
Molecular Properties
| Compound Name | 5-chloropentyl methyl carbonate |
| PubChem CID | 103970733 |
| Molecular Formula | C7H13ClO3 |
| Molecular Weight | 180.63 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 5-chloropentyl methyl carbonate |
| SMILES | COC(=O)OCCCCCCl |
| InChI | InChI=1S/C7H13ClO3/c1-10-7(9)11-6-4-2-3-5-8/h2-6H2,1H3 |
| InChIKey | HHFDDBYHSVXDNW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.63 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloropentyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloropentyl methyl carbonate?
The IUPAC name of 5-chloropentyl methyl carbonate (CID 103970733) is 5-chloropentyl methyl carbonate.
What is the SMILES notation for 5-chloropentyl methyl carbonate?
The canonical SMILES for 5-chloropentyl methyl carbonate is COC(=O)OCCCCCCl.
What is the InChIKey of 5-chloropentyl methyl carbonate?
The InChIKey is HHFDDBYHSVXDNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13ClO3/c1-10-7(9)11-6-4-2-3-5-8/h2-6H2,1H3.
What are the key properties of 5-chloropentyl methyl carbonate?
5-chloropentyl methyl carbonate has a molecular weight of 180.63 g/mol, XLogP of 2.18, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloropentyl methyl carbonate is sourced from PubChem (CID 103970733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).