C22H32F10O11 — CID 91730729
2-[2-[2-[2-[2-[2-[2-[2-(2,2,3,3,3-pentafluoropropanoyloxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91730729) has the molecular formula C22H32F10O11 and a molecular weight of 662.47 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-[2-(2,2,3,3,3-pentafluoropropanoyloxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-[2-(2,2,3,3,3-pentafluoropropanoyloxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91730729 |
| Molecular Formula | C22H32F10O11 |
| Molecular Weight | 662.47 g/mol |
| Exact Mass | 662.18 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-[2-(2,2,3,3,3-pentafluoropropanoyloxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(OCCOCCOCCOCCOCCOCCOCCOCCOC(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H32F10O11/c23-19(24,21(27,28)29)17(33)42-15-13-40-11-9-38-7-5-36-3-1-35-2-4-37-6-8-39-10-12-41-14-16-43-18(34)20(25,26)22(30,31)32/h1-16H2 |
| InChIKey | FVAIFCAWJMCJME-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 117.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|