C11H8ClF5O2 — CID 91715952
2-(4-chlorophenyl)ethyl 2,2,3,3,3-pentafluoropropanoate (PubChem CID 91715952) has the molecular formula C11H8ClF5O2 and a molecular weight of 302.63 g/mol. Its IUPAC name is 2-(4-chlorophenyl)ethyl 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | 2-(4-chlorophenyl)ethyl 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 91715952 |
| Molecular Formula | C11H8ClF5O2 |
| Molecular Weight | 302.63 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 2-(4-chlorophenyl)ethyl 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(OCCc1ccc(Cl)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H8ClF5O2/c12-8-3-1-7(2-4-8)5-6-19-9(18)10(13,14)11(15,16)17/h1-4H,5-6H2 |
| InChIKey | DNQGCYJHIIQJPF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.63 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|