C11H7ClF5NO — CID 74965622
3-amino-1-(4-chlorophenyl)-4,4,5,5,5-pentafluoropent-2-en-1-one (PubChem CID 74965622) has the molecular formula C11H7ClF5NO and a molecular weight of 299.63 g/mol. Its IUPAC name is 3-amino-1-(4-chlorophenyl)-4,4,5,5,5-pentafluoropent-2-en-1-one.
| Compound Name | 3-amino-1-(4-chlorophenyl)-4,4,5,5,5-pentafluoropent-2-en-1-one |
|---|---|
| PubChem CID | 74965622 |
| Molecular Formula | C11H7ClF5NO |
| Molecular Weight | 299.63 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 3-amino-1-(4-chlorophenyl)-4,4,5,5,5-pentafluoropent-2-en-1-one |
| SMILES | NC(=CC(=O)c1ccc(Cl)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H7ClF5NO/c12-7-3-1-6(2-4-7)8(19)5-9(18)10(13,14)11(15,16)17/h1-5H,18H2 |
| InChIKey | DPQFDNXOOPVEHC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.63 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|