C6H3F8NO — CID 117063906
(Z)-4-amino-1,1,1,5,5,6,6,6-octafluorohex-3-en-2-one (PubChem CID 117063906) has the molecular formula C6H3F8NO and a molecular weight of 257.08 g/mol. Its IUPAC name is (Z)-4-amino-1,1,1,5,5,6,6,6-octafluorohex-3-en-2-one.
| Compound Name | (Z)-4-amino-1,1,1,5,5,6,6,6-octafluorohex-3-en-2-one |
|---|---|
| PubChem CID | 117063906 |
| Molecular Formula | C6H3F8NO |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | (Z)-4-amino-1,1,1,5,5,6,6,6-octafluorohex-3-en-2-one |
| SMILES | N/C(=C\C(=O)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H3F8NO/c7-4(8,6(12,13)14)2(15)1-3(16)5(9,10)11/h1H,15H2/b2-1- |
| InChIKey | CEARCUILTTZAGF-UPHRSURJSA-N |
| XLogP | 2.16 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|