C10H13F5N2O2 — CID 167506955
ethyl (2Z,4Z)-2,5-diamino-6,6,7,7,7-pentafluoro-3-methylhepta-2,4-dienoate (PubChem CID 167506955) has the molecular formula C10H13F5N2O2 and a molecular weight of 288.22 g/mol. Its IUPAC name is ethyl (2Z,4Z)-2,5-diamino-6,6,7,7,7-pentafluoro-3-methylhepta-2,4-dienoate.
| Compound Name | ethyl (2Z,4Z)-2,5-diamino-6,6,7,7,7-pentafluoro-3-methylhepta-2,4-dienoate |
|---|---|
| PubChem CID | 167506955 |
| Molecular Formula | C10H13F5N2O2 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | ethyl (2Z,4Z)-2,5-diamino-6,6,7,7,7-pentafluoro-3-methylhepta-2,4-dienoate |
| SMILES | CCOC(=O)/C(N)=C(C)/C=C(\N)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13F5N2O2/c1-3-19-8(18)7(17)5(2)4-6(16)9(11,12)10(13,14)15/h4H,3,16-17H2,1-2H3/b6-4-,7-5- |
| InChIKey | VYWMOXJBSQEHTN-PEPZGXQESA-N |
| XLogP | 1.82 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|