C7H9F3N2O2 — CID 177007000
ethyl (Z)-4-amino-5,5,5-trifluoro-2-iminopent-3-enoate (PubChem CID 177007000) has the molecular formula C7H9F3N2O2 and a molecular weight of 210.16 g/mol. Its IUPAC name is ethyl (Z)-4-amino-5,5,5-trifluoro-2-iminopent-3-enoate.
| Compound Name | ethyl (Z)-4-amino-5,5,5-trifluoro-2-iminopent-3-enoate |
|---|---|
| PubChem CID | 177007000 |
| Molecular Formula | C7H9F3N2O2 |
| Molecular Weight | 210.16 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | ethyl (Z)-4-amino-5,5,5-trifluoro-2-iminopent-3-enoate |
| SMILES | [H]/N=C(/C=C(\N)C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C7H9F3N2O2/c1-2-14-6(13)4(11)3-5(12)7(8,9)10/h3,11H,2,12H2,1H3/b5-3-,11-4- |
| InChIKey | BICZWSKEZZIAKM-QULOGMOTSA-N |
| XLogP | 0.97 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.16 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|