C11H16F3NO2 — CID 172593050
ethyl 3-ethyl-2-(2,2,2-trifluoroethanimidoyl)pent-2-enoate (PubChem CID 172593050) has the molecular formula C11H16F3NO2 and a molecular weight of 251.25 g/mol. Its IUPAC name is ethyl 3-ethyl-2-(2,2,2-trifluoroethanimidoyl)pent-2-enoate.
| Compound Name | ethyl 3-ethyl-2-(2,2,2-trifluoroethanimidoyl)pent-2-enoate |
|---|---|
| PubChem CID | 172593050 |
| Molecular Formula | C11H16F3NO2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | ethyl 3-ethyl-2-(2,2,2-trifluoroethanimidoyl)pent-2-enoate |
| SMILES | [H]/N=C(/C(C(=O)OCC)=C(CC)CC)C(F)(F)F |
| InChI | InChI=1S/C11H16F3NO2/c1-4-7(5-2)8(10(16)17-6-3)9(15)11(12,13)14/h15H,4-6H2,1-3H3/b15-9- |
| InChIKey | ANKZIIHYQKUWAI-DHDCSXOGSA-N |
| XLogP | 3.25 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|