C8H10F3NO4 — CID 135451154
methyl (E)-3-hydroxy-4-methoxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate (PubChem CID 135451154) has the molecular formula C8H10F3NO4 and a molecular weight of 241.16 g/mol. Its IUPAC name is methyl (E)-3-hydroxy-4-methoxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate.
| Compound Name | methyl (E)-3-hydroxy-4-methoxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate |
|---|---|
| PubChem CID | 135451154 |
| Molecular Formula | C8H10F3NO4 |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | methyl (E)-3-hydroxy-4-methoxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate |
| SMILES | [H]/N=C(C(/C(=O)OC)=C(\O)COC)\C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO4/c1-15-3-4(13)5(7(14)16-2)6(12)8(9,10)11/h12-13H,3H2,1-2H3/b5-4+,12-6- |
| InChIKey | YJXUALJYKIGNQF-VULOCEMHSA-N |
| XLogP | 1.20 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|