C10H16O6 — CID 86626588
methyl 3,4-dimethoxy-2-(2-methoxyacetyl)but-2-enoate (PubChem CID 86626588) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is methyl 3,4-dimethoxy-2-(2-methoxyacetyl)but-2-enoate.
| Compound Name | methyl 3,4-dimethoxy-2-(2-methoxyacetyl)but-2-enoate |
|---|---|
| PubChem CID | 86626588 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | methyl 3,4-dimethoxy-2-(2-methoxyacetyl)but-2-enoate |
| SMILES | COCC(=O)C(C(=O)OC)=C(COC)OC |
| InChI | InChI=1S/C10H16O6/c1-13-5-7(11)9(10(12)16-4)8(15-3)6-14-2/h5-6H2,1-4H3 |
| InChIKey | IVZLVTWOLLNZQK-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|