C18H24O8 — CID 100993196
tetramethyl (4Z)-2,7-dimethylocta-2,4,6-triene-2,3,4,5-tetracarboxylate (PubChem CID 100993196) has the molecular formula C18H24O8 and a molecular weight of 368.38 g/mol. Its IUPAC name is tetramethyl (4Z)-2,7-dimethylocta-2,4,6-triene-2,3,4,5-tetracarboxylate.
| Compound Name | tetramethyl (4Z)-2,7-dimethylocta-2,4,6-triene-2,3,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 100993196 |
| Molecular Formula | C18H24O8 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | tetramethyl (4Z)-2,7-dimethylocta-2,4,6-triene-2,3,4,5-tetracarboxylate |
| SMILES | COC(=O)C(=C(C)C)/C(C(=O)OC)=C(/C(=O)OC)C(C(=O)OC)=C(C)C |
| InChI | InChI=1S/C18H24O8/c1-9(2)11(15(19)23-5)13(17(21)25-7)14(18(22)26-8)12(10(3)4)16(20)24-6/h1-8H3/b14-13- |
| InChIKey | JJWAIJWZPITZLA-YPKPFQOOSA-N |
| XLogP | 1.65 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|