About methyl 2-acetyl-3-methylbut-2-enoate;methyl 3-oxobutanoate
methyl 2-acetyl-3-methylbut-2-enoate;methyl 3-oxobutanoate (PubChem CID 163767625) has the molecular formula C13H20O6
and a molecular weight of 272.30 g/mol. Its IUPAC name is methyl 2-acetyl-3-methylbut-2-enoate;methyl 3-oxobutanoate.
Molecular Properties
| Compound Name | methyl 2-acetyl-3-methylbut-2-enoate;methyl 3-oxobutanoate |
| PubChem CID | 163767625 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | methyl 2-acetyl-3-methylbut-2-enoate;methyl 3-oxobutanoate |
| SMILES | COC(=O)C(C(C)=O)=C(C)C.COC(=O)CC(C)=O |
| InChI | InChI=1S/C8H12O3.C5H8O3/c1-5(2)7(6(3)9)8(10)11-4;1-4(6)3-5(7)8-2/h1-4H3;3H2,1-2H3 |
| InChIKey | MDSJUXBJGFWTJH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-acetyl-3-methylbut-2-enoate;methyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-acetyl-3-methylbut-2-enoate;methyl 3-oxobutanoate?
The IUPAC name of methyl 2-acetyl-3-methylbut-2-enoate;methyl 3-oxobutanoate (CID 163767625) is methyl 2-acetyl-3-methylbut-2-enoate;methyl 3-oxobutanoate.
What is the SMILES notation for methyl 2-acetyl-3-methylbut-2-enoate;methyl 3-oxobutanoate?
The canonical SMILES for methyl 2-acetyl-3-methylbut-2-enoate;methyl 3-oxobutanoate is COC(=O)C(C(C)=O)=C(C)C.COC(=O)CC(C)=O.
What is the InChIKey of methyl 2-acetyl-3-methylbut-2-enoate;methyl 3-oxobutanoate?
The InChIKey is MDSJUXBJGFWTJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3.C5H8O3/c1-5(2)7(6(3)9)8(10)11-4;1-4(6)3-5(7)8-2/h1-4H3;3H2,1-2H3.
What are the key properties of methyl 2-acetyl-3-methylbut-2-enoate;methyl 3-oxobutanoate?
methyl 2-acetyl-3-methylbut-2-enoate;methyl 3-oxobutanoate has a molecular weight of 272.30 g/mol, XLogP of 1.22, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetyl-3-methylbut-2-enoate;methyl 3-oxobutanoate is sourced from PubChem (CID 163767625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).