About alumane;butan-1-ol;methyl 3-oxobutanoate
alumane;butan-1-ol;methyl 3-oxobutanoate (PubChem CID 174784278) has the molecular formula C9H21AlO4
and a molecular weight of 220.24 g/mol. Its IUPAC name is alumane;butan-1-ol;methyl 3-oxobutanoate.
Molecular Properties
| Compound Name | alumane;butan-1-ol;methyl 3-oxobutanoate |
| PubChem CID | 174784278 |
| Molecular Formula | C9H21AlO4 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | alumane;butan-1-ol;methyl 3-oxobutanoate |
| SMILES | CCCCO.COC(=O)CC(C)=O.[AlH3] |
| InChI | InChI=1S/C5H8O3.C4H10O.Al.3H/c1-4(6)3-5(7)8-2;1-2-3-4-5;;;;/h3H2,1-2H3;5H,2-4H2,1H3;;;; |
| InChIKey | ZFGVAJOJZHBGFG-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze alumane;butan-1-ol;methyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;butan-1-ol;methyl 3-oxobutanoate?
The IUPAC name of alumane;butan-1-ol;methyl 3-oxobutanoate (CID 174784278) is alumane;butan-1-ol;methyl 3-oxobutanoate.
What is the SMILES notation for alumane;butan-1-ol;methyl 3-oxobutanoate?
The canonical SMILES for alumane;butan-1-ol;methyl 3-oxobutanoate is CCCCO.COC(=O)CC(C)=O.[AlH3].
What is the InChIKey of alumane;butan-1-ol;methyl 3-oxobutanoate?
The InChIKey is ZFGVAJOJZHBGFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3.C4H10O.Al.3H/c1-4(6)3-5(7)8-2;1-2-3-4-5;;;;/h3H2,1-2H3;5H,2-4H2,1H3;;;;.
What are the key properties of alumane;butan-1-ol;methyl 3-oxobutanoate?
alumane;butan-1-ol;methyl 3-oxobutanoate has a molecular weight of 220.24 g/mol, XLogP of -0.27, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;butan-1-ol;methyl 3-oxobutanoate is sourced from PubChem (CID 174784278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).