About butan-1-ol;pentane-2,4-dione
butan-1-ol;pentane-2,4-dione (PubChem CID 172713132) has the molecular formula C9H18O3
and a molecular weight of 174.24 g/mol. Its IUPAC name is butan-1-ol;pentane-2,4-dione.
Molecular Properties
| Compound Name | butan-1-ol;pentane-2,4-dione |
| PubChem CID | 172713132 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | butan-1-ol;pentane-2,4-dione |
| SMILES | CC(=O)CC(C)=O.CCCCO |
| InChI | InChI=1S/C5H8O2.C4H10O/c1-4(6)3-5(2)7;1-2-3-4-5/h3H2,1-2H3;5H,2-4H2,1H3 |
| InChIKey | FMVYZDRVKZGNGN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze butan-1-ol;pentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-ol;pentane-2,4-dione?
The IUPAC name of butan-1-ol;pentane-2,4-dione (CID 172713132) is butan-1-ol;pentane-2,4-dione.
What is the SMILES notation for butan-1-ol;pentane-2,4-dione?
The canonical SMILES for butan-1-ol;pentane-2,4-dione is CC(=O)CC(C)=O.CCCCO.
What is the InChIKey of butan-1-ol;pentane-2,4-dione?
The InChIKey is FMVYZDRVKZGNGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C4H10O/c1-4(6)3-5(2)7;1-2-3-4-5/h3H2,1-2H3;5H,2-4H2,1H3.
What are the key properties of butan-1-ol;pentane-2,4-dione?
butan-1-ol;pentane-2,4-dione has a molecular weight of 174.24 g/mol, XLogP of 1.33, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-ol;pentane-2,4-dione is sourced from PubChem (CID 172713132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).