C9H18O3Zr — CID 157243512
butan-1-ol;pentane-2,4-dione;zirconium (PubChem CID 157243512) has the molecular formula C9H18O3Zr and a molecular weight of 265.46 g/mol. Its IUPAC name is butan-1-ol;pentane-2,4-dione;zirconium.
| Compound Name | butan-1-ol;pentane-2,4-dione;zirconium |
|---|---|
| PubChem CID | 157243512 |
| Molecular Formula | C9H18O3Zr |
| Molecular Weight | 265.46 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | butan-1-ol;pentane-2,4-dione;zirconium |
| SMILES | CC(=O)CC(C)=O.CCCCO.[Zr] |
| InChI | InChI=1S/C5H8O2.C4H10O.Zr/c1-4(6)3-5(2)7;1-2-3-4-5;/h3H2,1-2H3;5H,2-4H2,1H3; |
| InChIKey | AVMIAZCENYNJPP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.46 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|